C12H21NO4 — CID 161495453
5-(dimethylamino)-2-methylpent-2-enoic acid;2-methylprop-2-enoic acid (PubChem CID 161495453) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is 5-(dimethylamino)-2-methylpent-2-enoic acid;2-methylprop-2-enoic acid.
| Compound Name | 5-(dimethylamino)-2-methylpent-2-enoic acid;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 161495453 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 5-(dimethylamino)-2-methylpent-2-enoic acid;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.CC(=CCCN(C)C)C(=O)O |
| InChI | InChI=1S/C8H15NO2.C4H6O2/c1-7(8(10)11)5-4-6-9(2)3;1-3(2)4(5)6/h5H,4,6H2,1-3H3,(H,10,11);1H2,2H3,(H,5,6) |
| InChIKey | WGDFMZWLSFZSDH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|