C17H29NO9 — CID 175878324
ethyl carbamate;5-hydroxy-2-methylpent-2-enoic acid;bis(2-methylprop-2-enoic acid) (PubChem CID 175878324) has the molecular formula C17H29NO9 and a molecular weight of 391.42 g/mol. Its IUPAC name is ethyl carbamate;5-hydroxy-2-methylpent-2-enoic acid;bis(2-methylprop-2-enoic acid).
| Compound Name | ethyl carbamate;5-hydroxy-2-methylpent-2-enoic acid;bis(2-methylprop-2-enoic acid) |
|---|---|
| PubChem CID | 175878324 |
| Molecular Formula | C17H29NO9 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | ethyl carbamate;5-hydroxy-2-methylpent-2-enoic acid;bis(2-methylprop-2-enoic acid) |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.CC(=CCCO)C(=O)O.CCOC(N)=O |
| InChI | InChI=1S/C6H10O3.2C4H6O2.C3H7NO2/c1-5(6(8)9)3-2-4-7;2*1-3(2)4(5)6;1-2-6-3(4)5/h3,7H,2,4H2,1H3,(H,8,9);2*1H2,2H3,(H,5,6);2H2,1H3,(H2,4,5) |
| InChIKey | NLCCNIFBGVKFTR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 184.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|