About ethyl carbamate;(E)-2-methylbut-2-enoic acid
ethyl carbamate;(E)-2-methylbut-2-enoic acid (PubChem CID 22492613) has the molecular formula C8H15NO4
and a molecular weight of 189.21 g/mol. Its IUPAC name is ethyl carbamate;(E)-2-methylbut-2-enoic acid.
Molecular Properties
| Compound Name | ethyl carbamate;(E)-2-methylbut-2-enoic acid |
| PubChem CID | 22492613 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | ethyl carbamate;(E)-2-methylbut-2-enoic acid |
| SMILES | C/C=C(\C)C(=O)O.CCOC(N)=O |
| InChI | InChI=1S/C5H8O2.C3H7NO2/c1-3-4(2)5(6)7;1-2-6-3(4)5/h3H,1-2H3,(H,6,7);2H2,1H3,(H2,4,5)/b4-3+; |
| InChIKey | IRAFEXSDPKHXMX-BJILWQEISA-N |
| XLogP | 1.14 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl carbamate;(E)-2-methylbut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl carbamate;(E)-2-methylbut-2-enoic acid?
The IUPAC name of ethyl carbamate;(E)-2-methylbut-2-enoic acid (CID 22492613) is ethyl carbamate;(E)-2-methylbut-2-enoic acid.
What is the SMILES notation for ethyl carbamate;(E)-2-methylbut-2-enoic acid?
The canonical SMILES for ethyl carbamate;(E)-2-methylbut-2-enoic acid is C/C=C(\C)C(=O)O.CCOC(N)=O.
What is the InChIKey of ethyl carbamate;(E)-2-methylbut-2-enoic acid?
The InChIKey is IRAFEXSDPKHXMX-BJILWQEISA-N. The full InChI is InChI=1S/C5H8O2.C3H7NO2/c1-3-4(2)5(6)7;1-2-6-3(4)5/h3H,1-2H3,(H,6,7);2H2,1H3,(H2,4,5)/b4-3+;.
What are the key properties of ethyl carbamate;(E)-2-methylbut-2-enoic acid?
ethyl carbamate;(E)-2-methylbut-2-enoic acid has a molecular weight of 189.21 g/mol, XLogP of 1.14, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl carbamate;(E)-2-methylbut-2-enoic acid is sourced from PubChem (CID 22492613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).