C14H24N2O9 — CID 87087096
3-[2-carboxyprop-1-enyl(ethoxycarbonyl)amino]-2-methylprop-2-enoic acid;ethyl carbamate;hydrate (PubChem CID 87087096) has the molecular formula C14H24N2O9 and a molecular weight of 364.35 g/mol. Its IUPAC name is 3-[2-carboxyprop-1-enyl(ethoxycarbonyl)amino]-2-methylprop-2-enoic acid;ethyl carbamate;hydrate.
| Compound Name | 3-[2-carboxyprop-1-enyl(ethoxycarbonyl)amino]-2-methylprop-2-enoic acid;ethyl carbamate;hydrate |
|---|---|
| PubChem CID | 87087096 |
| Molecular Formula | C14H24N2O9 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 3-[2-carboxyprop-1-enyl(ethoxycarbonyl)amino]-2-methylprop-2-enoic acid;ethyl carbamate;hydrate |
| SMILES | CCOC(=O)N(C=C(C)C(=O)O)C=C(C)C(=O)O.CCOC(N)=O.O |
| InChI | InChI=1S/C11H15NO6.C3H7NO2.H2O/c1-4-18-11(17)12(5-7(2)9(13)14)6-8(3)10(15)16;1-2-6-3(4)5;/h5-6H,4H2,1-3H3,(H,13,14)(H,15,16);2H2,1H3,(H2,4,5);1H2 |
| InChIKey | PTUPRPNRASYOEK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 187.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|