C12H20O6 — CID 173421757
5-hydroxy-2-methylpent-2-enoic acid;3-hydroxypropyl prop-2-enoate (PubChem CID 173421757) has the molecular formula C12H20O6 and a molecular weight of 260.29 g/mol. Its IUPAC name is 5-hydroxy-2-methylpent-2-enoic acid;3-hydroxypropyl prop-2-enoate.
| Compound Name | 5-hydroxy-2-methylpent-2-enoic acid;3-hydroxypropyl prop-2-enoate |
|---|---|
| PubChem CID | 173421757 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 5-hydroxy-2-methylpent-2-enoic acid;3-hydroxypropyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCO.CC(=CCCO)C(=O)O |
| InChI | InChI=1S/2C6H10O3/c1-5(6(8)9)3-2-4-7;1-2-6(8)9-5-3-4-7/h3,7H,2,4H2,1H3,(H,8,9);2,7H,1,3-5H2 |
| InChIKey | GSERZHQRVHTXJY-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|