C19H36N2O4 — CID 175959487
2-(diethylamino)ethyl prop-2-enoate;5-(diethylamino)-2-methylpent-2-enoic acid (PubChem CID 175959487) has the molecular formula C19H36N2O4 and a molecular weight of 356.51 g/mol. Its IUPAC name is 2-(diethylamino)ethyl prop-2-enoate;5-(diethylamino)-2-methylpent-2-enoic acid.
| Compound Name | 2-(diethylamino)ethyl prop-2-enoate;5-(diethylamino)-2-methylpent-2-enoic acid |
|---|---|
| PubChem CID | 175959487 |
| Molecular Formula | C19H36N2O4 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | 2-(diethylamino)ethyl prop-2-enoate;5-(diethylamino)-2-methylpent-2-enoic acid |
| SMILES | C=CC(=O)OCCN(CC)CC.CCN(CC)CCC=C(C)C(=O)O |
| InChI | InChI=1S/C10H19NO2.C9H17NO2/c1-4-11(5-2)8-6-7-9(3)10(12)13;1-4-9(11)12-8-7-10(5-2)6-3/h7H,4-6,8H2,1-3H3,(H,12,13);4H,1,5-8H2,2-3H3 |
| InChIKey | JIIFHKIUIGORGD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|