About ethane;ethene;(E)-3-nitrohept-3-ene
ethane;ethene;(E)-3-nitrohept-3-ene (PubChem CID 143326374) has the molecular formula C11H23NO2
and a molecular weight of 201.31 g/mol. Its IUPAC name is ethane;ethene;(E)-3-nitrohept-3-ene.
Molecular Properties
| Compound Name | ethane;ethene;(E)-3-nitrohept-3-ene |
| PubChem CID | 143326374 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | ethane;ethene;(E)-3-nitrohept-3-ene |
| SMILES | C=C.CC.CCC/C=C(\CC)[N+](=O)[O-] |
| InChI | InChI=1S/C7H13NO2.C2H6.C2H4/c1-3-5-6-7(4-2)8(9)10;2*1-2/h6H,3-5H2,1-2H3;1-2H3;1-2H2/b7-6+;; |
| InChIKey | GFXZJUYCUSALKB-KMXZHCNGSA-N |
| XLogP | 4.19 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethene;(E)-3-nitrohept-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethene;(E)-3-nitrohept-3-ene?
The IUPAC name of ethane;ethene;(E)-3-nitrohept-3-ene (CID 143326374) is ethane;ethene;(E)-3-nitrohept-3-ene.
What is the SMILES notation for ethane;ethene;(E)-3-nitrohept-3-ene?
The canonical SMILES for ethane;ethene;(E)-3-nitrohept-3-ene is C=C.CC.CCC/C=C(\CC)[N+](=O)[O-].
What is the InChIKey of ethane;ethene;(E)-3-nitrohept-3-ene?
The InChIKey is GFXZJUYCUSALKB-KMXZHCNGSA-N. The full InChI is InChI=1S/C7H13NO2.C2H6.C2H4/c1-3-5-6-7(4-2)8(9)10;2*1-2/h6H,3-5H2,1-2H3;1-2H3;1-2H2/b7-6+;;.
What are the key properties of ethane;ethene;(E)-3-nitrohept-3-ene?
ethane;ethene;(E)-3-nitrohept-3-ene has a molecular weight of 201.31 g/mol, XLogP of 4.19, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethene;(E)-3-nitrohept-3-ene is sourced from PubChem (CID 143326374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).