C9H15NO2 — CID 163823768
(3Z,5E)-5-nitronona-3,5-diene (PubChem CID 163823768) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is (3Z,5E)-5-nitronona-3,5-diene.
| Compound Name | (3Z,5E)-5-nitronona-3,5-diene |
|---|---|
| PubChem CID | 163823768 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | (3Z,5E)-5-nitronona-3,5-diene |
| SMILES | CC/C=C\C(=C/CCC)[N+](=O)[O-] |
| InChI | InChI=1S/C9H15NO2/c1-3-5-7-9(10(11)12)8-6-4-2/h5,7-8H,3-4,6H2,1-2H3/b7-5-,9-8+ |
| InChIKey | NXRJPTFOMGCXET-SUHGFZJFSA-N |
| XLogP | 2.91 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|