About (Z)-2-oxohex-3-enoate
(Z)-2-oxohex-3-enoate (PubChem CID 25244119) has the molecular formula C6H7O3-
and a molecular weight of 127.12 g/mol. Its IUPAC name is (Z)-2-oxohex-3-enoate.
Molecular Properties
| Compound Name | (Z)-2-oxohex-3-enoate |
| PubChem CID | 25244119 |
| Molecular Formula | C6H7O3- |
| Molecular Weight | 127.12 g/mol |
| Exact Mass | 127.04 |
| IUPAC Name | (Z)-2-oxohex-3-enoate |
| SMILES | CC/C=C\C(=O)C(=O)[O-] |
| InChI | InChI=1S/C6H8O3/c1-2-3-4-5(7)6(8)9/h3-4H,2H2,1H3,(H,8,9)/p-1/b4-3- |
| InChIKey | SKGFXOFUJGUPDM-ARJAWSKDSA-M |
| XLogP | -0.73 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.12 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-oxohex-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-oxohex-3-enoate?
The IUPAC name of (Z)-2-oxohex-3-enoate (CID 25244119) is (Z)-2-oxohex-3-enoate.
What is the SMILES notation for (Z)-2-oxohex-3-enoate?
The canonical SMILES for (Z)-2-oxohex-3-enoate is CC/C=C\C(=O)C(=O)[O-].
What is the InChIKey of (Z)-2-oxohex-3-enoate?
The InChIKey is SKGFXOFUJGUPDM-ARJAWSKDSA-M. The full InChI is InChI=1S/C6H8O3/c1-2-3-4-5(7)6(8)9/h3-4H,2H2,1H3,(H,8,9)/p-1/b4-3-.
What are the key properties of (Z)-2-oxohex-3-enoate?
(Z)-2-oxohex-3-enoate has a molecular weight of 127.12 g/mol, XLogP of -0.73, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-oxohex-3-enoate is sourced from PubChem (CID 25244119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).