C10H18O2 — CID 124705258
(E,3R)-3-hydroxy-2,2-dimethyloct-5-en-4-one (PubChem CID 124705258) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (E,3R)-3-hydroxy-2,2-dimethyloct-5-en-4-one.
| Compound Name | (E,3R)-3-hydroxy-2,2-dimethyloct-5-en-4-one |
|---|---|
| PubChem CID | 124705258 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (E,3R)-3-hydroxy-2,2-dimethyloct-5-en-4-one |
| SMILES | CC/C=C/C(=O)[C@H](O)C(C)(C)C |
| InChI | InChI=1S/C10H18O2/c1-5-6-7-8(11)9(12)10(2,3)4/h6-7,9,12H,5H2,1-4H3/b7-6+/t9-/m0/s1 |
| InChIKey | ZDELJYDUDBYQEP-UCUJLANTSA-N |
| XLogP | 1.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|