About (E)-2-oxohex-3-enedioate
(E)-2-oxohex-3-enedioate (PubChem CID 25245156) has the molecular formula C6H4O5-2
and a molecular weight of 156.09 g/mol. Its IUPAC name is (E)-2-oxohex-3-enedioate.
Molecular Properties
| Compound Name | (E)-2-oxohex-3-enedioate |
| PubChem CID | 25245156 |
| Molecular Formula | C6H4O5-2 |
| Molecular Weight | 156.09 g/mol |
| Exact Mass | 156.01 |
| IUPAC Name | (E)-2-oxohex-3-enedioate |
| SMILES | O=C([O-])C/C=C/C(=O)C(=O)[O-] |
| InChI | InChI=1S/C6H6O5/c7-4(6(10)11)2-1-3-5(8)9/h1-2H,3H2,(H,8,9)(H,10,11)/p-2/b2-1+ |
| InChIKey | QTHJXLFFFTVYJC-OWOJBTEDSA-L |
| XLogP | -3.00 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.09 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-oxohex-3-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-oxohex-3-enedioate?
The IUPAC name of (E)-2-oxohex-3-enedioate (CID 25245156) is (E)-2-oxohex-3-enedioate.
What is the SMILES notation for (E)-2-oxohex-3-enedioate?
The canonical SMILES for (E)-2-oxohex-3-enedioate is O=C([O-])C/C=C/C(=O)C(=O)[O-].
What is the InChIKey of (E)-2-oxohex-3-enedioate?
The InChIKey is QTHJXLFFFTVYJC-OWOJBTEDSA-L. The full InChI is InChI=1S/C6H6O5/c7-4(6(10)11)2-1-3-5(8)9/h1-2H,3H2,(H,8,9)(H,10,11)/p-2/b2-1+.
What are the key properties of (E)-2-oxohex-3-enedioate?
(E)-2-oxohex-3-enedioate has a molecular weight of 156.09 g/mol, XLogP of -3.00, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-oxohex-3-enedioate is sourced from PubChem (CID 25245156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).