C7H9NaO2 — CID 102011094
sodium (3E,5E)-hepta-3,5-dienoate (PubChem CID 102011094) has the molecular formula C7H9NaO2 and a molecular weight of 148.14 g/mol. Its IUPAC name is sodium (3E,5E)-hepta-3,5-dienoate.
| Compound Name | sodium (3E,5E)-hepta-3,5-dienoate |
|---|---|
| PubChem CID | 102011094 |
| Molecular Formula | C7H9NaO2 |
| Molecular Weight | 148.14 g/mol |
| Exact Mass | 148.05 |
| IUPAC Name | sodium (3E,5E)-hepta-3,5-dienoate |
| SMILES | C/C=C/C=C/CC(=O)[O-].[Na+] |
| InChI | InChI=1S/C7H10O2.Na/c1-2-3-4-5-6-7(8)9;/h2-5H,6H2,1H3,(H,8,9);/q;+1/p-1/b3-2+,5-4+; |
| InChIKey | LOKUPLIUJFTOMQ-STWYSWDKSA-M |
| XLogP | -2.74 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.14 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|