2-ethylidenedeca-4,6,8-trienoic acid

C12H16O2 — CID 175425345

IUPAC2-ethylidenedeca-4,6,8-trienoic acid
SMILESCC=CC=CC=CCC(=CC)C(=O)O
InChIInChI=1S/C12H16O2/c1-3-5-6-7-8-9-10-11(4-2)12(13)14/h3-9H,10H2,1-2H3,(H,13,14)
InChIKeyZHPMQQHTKDVPNT-UHFFFAOYSA-N
MW192.26 g/mol
LogP3.10
Rot. Bonds5

About 2-ethylidenedeca-4,6,8-trienoic acid

2-ethylidenedeca-4,6,8-trienoic acid (PubChem CID 175425345) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-ethylidenedeca-4,6,8-trienoic acid.

Molecular Properties

Compound Name2-ethylidenedeca-4,6,8-trienoic acid
PubChem CID175425345
Molecular FormulaC12H16O2
Molecular Weight192.26 g/mol
Exact Mass192.12
IUPAC Name2-ethylidenedeca-4,6,8-trienoic acid
SMILESCC=CC=CC=CCC(=CC)C(=O)O
InChIInChI=1S/C12H16O2/c1-3-5-6-7-8-9-10-11(4-2)12(13)14/h3-9H,10H2,1-2H3,(H,13,14)
InChIKeyZHPMQQHTKDVPNT-UHFFFAOYSA-N
XLogP3.10
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.26
LogP ≤ 53.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 2-ethylidenedeca-4,6,8-trienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethylidenedeca-4,6,8-trienoic acid?
The IUPAC name of 2-ethylidenedeca-4,6,8-trienoic acid (CID 175425345) is 2-ethylidenedeca-4,6,8-trienoic acid.
What is the SMILES notation for 2-ethylidenedeca-4,6,8-trienoic acid?
The canonical SMILES for 2-ethylidenedeca-4,6,8-trienoic acid is CC=CC=CC=CCC(=CC)C(=O)O.
What is the InChIKey of 2-ethylidenedeca-4,6,8-trienoic acid?
The InChIKey is ZHPMQQHTKDVPNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2/c1-3-5-6-7-8-9-10-11(4-2)12(13)14/h3-9H,10H2,1-2H3,(H,13,14).
What are the key properties of 2-ethylidenedeca-4,6,8-trienoic acid?
2-ethylidenedeca-4,6,8-trienoic acid has a molecular weight of 192.26 g/mol, XLogP of 3.10, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylidenedeca-4,6,8-trienoic acid is sourced from PubChem (CID 175425345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).