C12H16O2 — CID 175425345
2-ethylidenedeca-4,6,8-trienoic acid (PubChem CID 175425345) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-ethylidenedeca-4,6,8-trienoic acid.
| Compound Name | 2-ethylidenedeca-4,6,8-trienoic acid |
|---|---|
| PubChem CID | 175425345 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 2-ethylidenedeca-4,6,8-trienoic acid |
| SMILES | CC=CC=CC=CCC(=CC)C(=O)O |
| InChI | InChI=1S/C12H16O2/c1-3-5-6-7-8-9-10-11(4-2)12(13)14/h3-9H,10H2,1-2H3,(H,13,14) |
| InChIKey | ZHPMQQHTKDVPNT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|