C9H14O2 — CID 101190230
(Z,2E)-2-ethylidenehept-5-enoic acid (PubChem CID 101190230) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is (Z,2E)-2-ethylidenehept-5-enoic acid.
| Compound Name | (Z,2E)-2-ethylidenehept-5-enoic acid |
|---|---|
| PubChem CID | 101190230 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | (Z,2E)-2-ethylidenehept-5-enoic acid |
| SMILES | C/C=C\CC/C(=C\C)C(=O)O |
| InChI | InChI=1S/C9H14O2/c1-3-5-6-7-8(4-2)9(10)11/h3-5H,6-7H2,1-2H3,(H,10,11)/b5-3-,8-4+ |
| InChIKey | VSPNRJZQSLGMJH-VOGDQUTBSA-N |
| XLogP | 2.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|