About acetic acid;2-ethylideneheptanoic acid
acetic acid;2-ethylideneheptanoic acid (PubChem CID 161103841) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is acetic acid;2-ethylideneheptanoic acid.
Molecular Properties
| Compound Name | acetic acid;2-ethylideneheptanoic acid |
| PubChem CID | 161103841 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | acetic acid;2-ethylideneheptanoic acid |
| SMILES | CC(=O)O.CC=C(CCCCC)C(=O)O |
| InChI | InChI=1S/C9H16O2.C2H4O2/c1-3-5-6-7-8(4-2)9(10)11;1-2(3)4/h4H,3,5-7H2,1-2H3,(H,10,11);1H3,(H,3,4) |
| InChIKey | UIUFCKFXSDLKTM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;2-ethylideneheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;2-ethylideneheptanoic acid?
The IUPAC name of acetic acid;2-ethylideneheptanoic acid (CID 161103841) is acetic acid;2-ethylideneheptanoic acid.
What is the SMILES notation for acetic acid;2-ethylideneheptanoic acid?
The canonical SMILES for acetic acid;2-ethylideneheptanoic acid is CC(=O)O.CC=C(CCCCC)C(=O)O.
What is the InChIKey of acetic acid;2-ethylideneheptanoic acid?
The InChIKey is UIUFCKFXSDLKTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2.C2H4O2/c1-3-5-6-7-8(4-2)9(10)11;1-2(3)4/h4H,3,5-7H2,1-2H3,(H,10,11);1H3,(H,3,4).
What are the key properties of acetic acid;2-ethylideneheptanoic acid?
acetic acid;2-ethylideneheptanoic acid has a molecular weight of 216.28 g/mol, XLogP of 2.69, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-ethylideneheptanoic acid is sourced from PubChem (CID 161103841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).