acetic acid;2-ethylideneheptanoic acid

C11H20O4 — CID 161103841

IUPACacetic acid;2-ethylideneheptanoic acid
SMILESCC(=O)O.CC=C(CCCCC)C(=O)O
InChIInChI=1S/C9H16O2.C2H4O2/c1-3-5-6-7-8(4-2)9(10)11;1-2(3)4/h4H,3,5-7H2,1-2H3,(H,10,11);1H3,(H,3,4)
InChIKeyUIUFCKFXSDLKTM-UHFFFAOYSA-N
MW216.28 g/mol
LogP2.69
Rot. Bonds5

About acetic acid;2-ethylideneheptanoic acid

acetic acid;2-ethylideneheptanoic acid (PubChem CID 161103841) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is acetic acid;2-ethylideneheptanoic acid.

Molecular Properties

Compound Nameacetic acid;2-ethylideneheptanoic acid
PubChem CID161103841
Molecular FormulaC11H20O4
Molecular Weight216.28 g/mol
Exact Mass216.14
IUPAC Nameacetic acid;2-ethylideneheptanoic acid
SMILESCC(=O)O.CC=C(CCCCC)C(=O)O
InChIInChI=1S/C9H16O2.C2H4O2/c1-3-5-6-7-8(4-2)9(10)11;1-2(3)4/h4H,3,5-7H2,1-2H3,(H,10,11);1H3,(H,3,4)
InChIKeyUIUFCKFXSDLKTM-UHFFFAOYSA-N
XLogP2.69
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.28
LogP ≤ 52.69
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze acetic acid;2-ethylideneheptanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;2-ethylideneheptanoic acid?
The IUPAC name of acetic acid;2-ethylideneheptanoic acid (CID 161103841) is acetic acid;2-ethylideneheptanoic acid.
What is the SMILES notation for acetic acid;2-ethylideneheptanoic acid?
The canonical SMILES for acetic acid;2-ethylideneheptanoic acid is CC(=O)O.CC=C(CCCCC)C(=O)O.
What is the InChIKey of acetic acid;2-ethylideneheptanoic acid?
The InChIKey is UIUFCKFXSDLKTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2.C2H4O2/c1-3-5-6-7-8(4-2)9(10)11;1-2(3)4/h4H,3,5-7H2,1-2H3,(H,10,11);1H3,(H,3,4).
What are the key properties of acetic acid;2-ethylideneheptanoic acid?
acetic acid;2-ethylideneheptanoic acid has a molecular weight of 216.28 g/mol, XLogP of 2.69, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-ethylideneheptanoic acid is sourced from PubChem (CID 161103841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).