2-ethylidenehex-4-enoic acid

C8H12O2 — CID 154267649

IUPAC2-ethylidenehex-4-enoic acid
SMILESCC=CCC(=CC)C(=O)O
InChIInChI=1S/C8H12O2/c1-3-5-6-7(4-2)8(9)10/h3-5H,6H2,1-2H3,(H,9,10)
InChIKeyUPVUPTQRLFGMLL-UHFFFAOYSA-N
MW140.18 g/mol
LogP1.98
Rot. Bonds3

About 2-ethylidenehex-4-enoic acid

2-ethylidenehex-4-enoic acid (PubChem CID 154267649) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is 2-ethylidenehex-4-enoic acid.

Molecular Properties

Compound Name2-ethylidenehex-4-enoic acid
PubChem CID154267649
Molecular FormulaC8H12O2
Molecular Weight140.18 g/mol
Exact Mass140.08
IUPAC Name2-ethylidenehex-4-enoic acid
SMILESCC=CCC(=CC)C(=O)O
InChIInChI=1S/C8H12O2/c1-3-5-6-7(4-2)8(9)10/h3-5H,6H2,1-2H3,(H,9,10)
InChIKeyUPVUPTQRLFGMLL-UHFFFAOYSA-N
XLogP1.98
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500140.18
LogP ≤ 51.98
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-ethylidenehex-4-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethylidenehex-4-enoic acid?
The IUPAC name of 2-ethylidenehex-4-enoic acid (CID 154267649) is 2-ethylidenehex-4-enoic acid.
What is the SMILES notation for 2-ethylidenehex-4-enoic acid?
The canonical SMILES for 2-ethylidenehex-4-enoic acid is CC=CCC(=CC)C(=O)O.
What is the InChIKey of 2-ethylidenehex-4-enoic acid?
The InChIKey is UPVUPTQRLFGMLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2/c1-3-5-6-7(4-2)8(9)10/h3-5H,6H2,1-2H3,(H,9,10).
What are the key properties of 2-ethylidenehex-4-enoic acid?
2-ethylidenehex-4-enoic acid has a molecular weight of 140.18 g/mol, XLogP of 1.98, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylidenehex-4-enoic acid is sourced from PubChem (CID 154267649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).