About sodium;hept-5-enoic acid;hydride
sodium;hept-5-enoic acid;hydride (PubChem CID 174384913) has the molecular formula C7H13NaO2
and a molecular weight of 152.17 g/mol. Its IUPAC name is sodium;hept-5-enoic acid;hydride.
Molecular Properties
| Compound Name | sodium;hept-5-enoic acid;hydride |
| PubChem CID | 174384913 |
| Molecular Formula | C7H13NaO2 |
| Molecular Weight | 152.17 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | sodium;hept-5-enoic acid;hydride |
| SMILES | CC=CCCCC(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C7H12O2.Na.H/c1-2-3-4-5-6-7(8)9;;/h2-3H,4-6H2,1H3,(H,8,9);;/q;+1;-1 |
| InChIKey | IKNYWNFVTKTFMD-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.17 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze sodium;hept-5-enoic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hept-5-enoic acid;hydride?
The IUPAC name of sodium;hept-5-enoic acid;hydride (CID 174384913) is sodium;hept-5-enoic acid;hydride.
What is the SMILES notation for sodium;hept-5-enoic acid;hydride?
The canonical SMILES for sodium;hept-5-enoic acid;hydride is CC=CCCCC(=O)O.[H-].[Na+].
What is the InChIKey of sodium;hept-5-enoic acid;hydride?
The InChIKey is IKNYWNFVTKTFMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.Na.H/c1-2-3-4-5-6-7(8)9;;/h2-3H,4-6H2,1H3,(H,8,9);;/q;+1;-1.
What are the key properties of sodium;hept-5-enoic acid;hydride?
sodium;hept-5-enoic acid;hydride has a molecular weight of 152.17 g/mol, XLogP of -1.07, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hept-5-enoic acid;hydride is sourced from PubChem (CID 174384913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).