About (E)-hept-5-enamide
(E)-hept-5-enamide (PubChem CID 18415105) has the molecular formula C7H13NO
and a molecular weight of 127.19 g/mol. Its IUPAC name is (E)-hept-5-enamide.
Molecular Properties
| Compound Name | (E)-hept-5-enamide |
| PubChem CID | 18415105 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | (E)-hept-5-enamide |
| SMILES | C/C=C/CCCC(N)=O |
| InChI | InChI=1S/C7H13NO/c1-2-3-4-5-6-7(8)9/h2-3H,4-6H2,1H3,(H2,8,9)/b3-2+ |
| InChIKey | KDZMEZRLDMNVMZ-NSCUHMNNSA-N |
| XLogP | 1.22 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-hept-5-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-hept-5-enamide?
The IUPAC name of (E)-hept-5-enamide (CID 18415105) is (E)-hept-5-enamide.
What is the SMILES notation for (E)-hept-5-enamide?
The canonical SMILES for (E)-hept-5-enamide is C/C=C/CCCC(N)=O.
What is the InChIKey of (E)-hept-5-enamide?
The InChIKey is KDZMEZRLDMNVMZ-NSCUHMNNSA-N. The full InChI is InChI=1S/C7H13NO/c1-2-3-4-5-6-7(8)9/h2-3H,4-6H2,1H3,(H2,8,9)/b3-2+.
What are the key properties of (E)-hept-5-enamide?
(E)-hept-5-enamide has a molecular weight of 127.19 g/mol, XLogP of 1.22, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-hept-5-enamide is sourced from PubChem (CID 18415105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).