C20H36N2O2 — CID 154110661
icosa-8,12-dienediamide (PubChem CID 154110661) has the molecular formula C20H36N2O2 and a molecular weight of 336.52 g/mol. Its IUPAC name is icosa-8,12-dienediamide.
| Compound Name | icosa-8,12-dienediamide |
|---|---|
| PubChem CID | 154110661 |
| Molecular Formula | C20H36N2O2 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.28 |
| IUPAC Name | icosa-8,12-dienediamide |
| SMILES | NC(=O)CCCCCCC=CCCC=CCCCCCCC(N)=O |
| InChI | InChI=1S/C20H36N2O2/c21-19(23)17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20(22)24/h3-6H,1-2,7-18H2,(H2,21,23)(H2,22,24) |
| InChIKey | CWNFYTZPNXOUBS-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|