About (E)-hexadec-8-enediamide
(E)-hexadec-8-enediamide (PubChem CID 21140246) has the molecular formula C16H30N2O2
and a molecular weight of 282.43 g/mol. Its IUPAC name is (E)-hexadec-8-enediamide.
Molecular Properties
| Compound Name | (E)-hexadec-8-enediamide |
| PubChem CID | 21140246 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | (E)-hexadec-8-enediamide |
| SMILES | NC(=O)CCCCCC/C=C/CCCCCCC(N)=O |
| InChI | InChI=1S/C16H30N2O2/c17-15(19)13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(18)20/h1-2H,3-14H2,(H2,17,19)(H2,18,20)/b2-1+ |
| InChIKey | CXJZVJZMQQDDCJ-OWOJBTEDSA-N |
| XLogP | 3.19 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-hexadec-8-enediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-hexadec-8-enediamide?
The IUPAC name of (E)-hexadec-8-enediamide (CID 21140246) is (E)-hexadec-8-enediamide.
What is the SMILES notation for (E)-hexadec-8-enediamide?
The canonical SMILES for (E)-hexadec-8-enediamide is NC(=O)CCCCCC/C=C/CCCCCCC(N)=O.
What is the InChIKey of (E)-hexadec-8-enediamide?
The InChIKey is CXJZVJZMQQDDCJ-OWOJBTEDSA-N. The full InChI is InChI=1S/C16H30N2O2/c17-15(19)13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(18)20/h1-2H,3-14H2,(H2,17,19)(H2,18,20)/b2-1+.
What are the key properties of (E)-hexadec-8-enediamide?
(E)-hexadec-8-enediamide has a molecular weight of 282.43 g/mol, XLogP of 3.19, 14 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-hexadec-8-enediamide is sourced from PubChem (CID 21140246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).