About (Z)-non-7-enamide
(Z)-non-7-enamide (PubChem CID 5365368) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is (Z)-non-7-enamide.
Molecular Properties
| Compound Name | (Z)-non-7-enamide |
| PubChem CID | 5365368 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | (Z)-non-7-enamide |
| SMILES | C/C=C\CCCCCC(N)=O |
| InChI | InChI=1S/C9H17NO/c1-2-3-4-5-6-7-8-9(10)11/h2-3H,4-8H2,1H3,(H2,10,11)/b3-2- |
| InChIKey | NERNEXDYZBHYKN-IHWYPQMZSA-N |
| XLogP | 2.00 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-non-7-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-non-7-enamide?
The IUPAC name of (Z)-non-7-enamide (CID 5365368) is (Z)-non-7-enamide.
What is the SMILES notation for (Z)-non-7-enamide?
The canonical SMILES for (Z)-non-7-enamide is C/C=C\CCCCCC(N)=O.
What is the InChIKey of (Z)-non-7-enamide?
The InChIKey is NERNEXDYZBHYKN-IHWYPQMZSA-N. The full InChI is InChI=1S/C9H17NO/c1-2-3-4-5-6-7-8-9(10)11/h2-3H,4-8H2,1H3,(H2,10,11)/b3-2-.
What are the key properties of (Z)-non-7-enamide?
(Z)-non-7-enamide has a molecular weight of 155.24 g/mol, XLogP of 2.00, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-non-7-enamide is sourced from PubChem (CID 5365368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).