C9H15NO2 — CID 134939461
(3E,5E)-N-methoxy-N-methylhepta-3,5-dienamide (PubChem CID 134939461) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is (3E,5E)-N-methoxy-N-methylhepta-3,5-dienamide.
| Compound Name | (3E,5E)-N-methoxy-N-methylhepta-3,5-dienamide |
|---|---|
| PubChem CID | 134939461 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | (3E,5E)-N-methoxy-N-methylhepta-3,5-dienamide |
| SMILES | C/C=C/C=C/CC(=O)N(C)OC |
| InChI | InChI=1S/C9H15NO2/c1-4-5-6-7-8-9(11)10(2)12-3/h4-7H,8H2,1-3H3/b5-4+,7-6+ |
| InChIKey | OVGMJRNNYWDWFA-YTXTXJHMSA-N |
| XLogP | 1.53 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|