C12H14O2 — CID 164671294
(2E,6E,8E,10E)-5-oxododeca-2,6,8,10-tetraenal (PubChem CID 164671294) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is (2E,6E,8E,10E)-5-oxododeca-2,6,8,10-tetraenal.
| Compound Name | (2E,6E,8E,10E)-5-oxododeca-2,6,8,10-tetraenal |
|---|---|
| PubChem CID | 164671294 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | (2E,6E,8E,10E)-5-oxododeca-2,6,8,10-tetraenal |
| SMILES | C/C=C/C=C/C=C/C(=O)C/C=C/C=O |
| InChI | InChI=1S/C12H14O2/c1-2-3-4-5-6-9-12(14)10-7-8-11-13/h2-9,11H,10H2,1H3/b3-2+,5-4+,8-7+,9-6+ |
| InChIKey | LBXRZSNCXXYVOS-JMZQEZEBSA-N |
| XLogP | 2.39 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|