About hexa-2,4-dienal;hex-4-en-3-one
hexa-2,4-dienal;hex-4-en-3-one (PubChem CID 173273748) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is hexa-2,4-dienal;hex-4-en-3-one.
Molecular Properties
| Compound Name | hexa-2,4-dienal;hex-4-en-3-one |
| PubChem CID | 173273748 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | hexa-2,4-dienal;hex-4-en-3-one |
| SMILES | CC=CC(=O)CC.CC=CC=CC=O |
| InChI | InChI=1S/C6H10O.C6H8O/c1-3-5-6(7)4-2;1-2-3-4-5-6-7/h3,5H,4H2,1-2H3;2-6H,1H3 |
| InChIKey | GIEPIWJQYPGNPF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze hexa-2,4-dienal;hex-4-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexa-2,4-dienal;hex-4-en-3-one?
The IUPAC name of hexa-2,4-dienal;hex-4-en-3-one (CID 173273748) is hexa-2,4-dienal;hex-4-en-3-one.
What is the SMILES notation for hexa-2,4-dienal;hex-4-en-3-one?
The canonical SMILES for hexa-2,4-dienal;hex-4-en-3-one is CC=CC(=O)CC.CC=CC=CC=O.
What is the InChIKey of hexa-2,4-dienal;hex-4-en-3-one?
The InChIKey is GIEPIWJQYPGNPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O.C6H8O/c1-3-5-6(7)4-2;1-2-3-4-5-6-7/h3,5H,4H2,1-2H3;2-6H,1H3.
What are the key properties of hexa-2,4-dienal;hex-4-en-3-one?
hexa-2,4-dienal;hex-4-en-3-one has a molecular weight of 194.27 g/mol, XLogP of 2.86, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexa-2,4-dienal;hex-4-en-3-one is sourced from PubChem (CID 173273748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).