C8H12O2 — CID 54438744
oct-6-ene-3,5-dione (PubChem CID 54438744) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is oct-6-ene-3,5-dione.
| Compound Name | oct-6-ene-3,5-dione |
|---|---|
| PubChem CID | 54438744 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | oct-6-ene-3,5-dione |
| SMILES | CC=CC(=O)CC(=O)CC |
| InChI | InChI=1S/C8H12O2/c1-3-5-8(10)6-7(9)4-2/h3,5H,4,6H2,1-2H3 |
| InChIKey | WMOTWRVUQUOPEU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|