About 1-(methylamino)pent-3-en-2-one;xenon;hydrofluoride
1-(methylamino)pent-3-en-2-one;xenon;hydrofluoride (PubChem CID 172819969) has the molecular formula C6H12FNOXe
and a molecular weight of 264.46 g/mol. Its IUPAC name is 1-(methylamino)pent-3-en-2-one;xenon;hydrofluoride.
Molecular Properties
| Compound Name | 1-(methylamino)pent-3-en-2-one;xenon;hydrofluoride |
| PubChem CID | 172819969 |
| Molecular Formula | C6H12FNOXe |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.99 |
| IUPAC Name | 1-(methylamino)pent-3-en-2-one;xenon;hydrofluoride |
| SMILES | CC=CC(=O)CNC.F.[Xe] |
| InChI | InChI=1S/C6H11NO.FH.Xe/c1-3-4-6(8)5-7-2;;/h3-4,7H,5H2,1-2H3;1H; |
| InChIKey | UCCYMXMUDMWZTG-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(methylamino)pent-3-en-2-one;xenon;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(methylamino)pent-3-en-2-one;xenon;hydrofluoride?
The IUPAC name of 1-(methylamino)pent-3-en-2-one;xenon;hydrofluoride (CID 172819969) is 1-(methylamino)pent-3-en-2-one;xenon;hydrofluoride.
What is the SMILES notation for 1-(methylamino)pent-3-en-2-one;xenon;hydrofluoride?
The canonical SMILES for 1-(methylamino)pent-3-en-2-one;xenon;hydrofluoride is CC=CC(=O)CNC.F.[Xe].
What is the InChIKey of 1-(methylamino)pent-3-en-2-one;xenon;hydrofluoride?
The InChIKey is UCCYMXMUDMWZTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.FH.Xe/c1-3-4-6(8)5-7-2;;/h3-4,7H,5H2,1-2H3;1H;.
What are the key properties of 1-(methylamino)pent-3-en-2-one;xenon;hydrofluoride?
1-(methylamino)pent-3-en-2-one;xenon;hydrofluoride has a molecular weight of 264.46 g/mol, XLogP of 0.50, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(methylamino)pent-3-en-2-one;xenon;hydrofluoride is sourced from PubChem (CID 172819969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).