About 1-aminopent-3-en-2-one;tetrahydrofluoride
1-aminopent-3-en-2-one;tetrahydrofluoride (PubChem CID 173491029) has the molecular formula C5H13F4NO
and a molecular weight of 179.16 g/mol. Its IUPAC name is 1-aminopent-3-en-2-one;tetrahydrofluoride.
Molecular Properties
| Compound Name | 1-aminopent-3-en-2-one;tetrahydrofluoride |
| PubChem CID | 173491029 |
| Molecular Formula | C5H13F4NO |
| Molecular Weight | 179.16 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 1-aminopent-3-en-2-one;tetrahydrofluoride |
| SMILES | CC=CC(=O)CN.F.F.F.F |
| InChI | InChI=1S/C5H9NO.4FH/c1-2-3-5(7)4-6;;;;/h2-3H,4,6H2,1H3;4*1H |
| InChIKey | FRAWDHJDFOMEKC-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.16 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-aminopent-3-en-2-one;tetrahydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminopent-3-en-2-one;tetrahydrofluoride?
The IUPAC name of 1-aminopent-3-en-2-one;tetrahydrofluoride (CID 173491029) is 1-aminopent-3-en-2-one;tetrahydrofluoride.
What is the SMILES notation for 1-aminopent-3-en-2-one;tetrahydrofluoride?
The canonical SMILES for 1-aminopent-3-en-2-one;tetrahydrofluoride is CC=CC(=O)CN.F.F.F.F.
What is the InChIKey of 1-aminopent-3-en-2-one;tetrahydrofluoride?
The InChIKey is FRAWDHJDFOMEKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO.4FH/c1-2-3-5(7)4-6;;;;/h2-3H,4,6H2,1H3;4*1H.
What are the key properties of 1-aminopent-3-en-2-one;tetrahydrofluoride?
1-aminopent-3-en-2-one;tetrahydrofluoride has a molecular weight of 179.16 g/mol, XLogP of 0.70, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminopent-3-en-2-one;tetrahydrofluoride is sourced from PubChem (CID 173491029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).