About methane;(E)-oct-6-ene-2,5-dione
methane;(E)-oct-6-ene-2,5-dione (PubChem CID 159043306) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is methane;(E)-oct-6-ene-2,5-dione.
Molecular Properties
| Compound Name | methane;(E)-oct-6-ene-2,5-dione |
| PubChem CID | 159043306 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | methane;(E)-oct-6-ene-2,5-dione |
| SMILES | C.C/C=C/C(=O)CCC(C)=O |
| InChI | InChI=1S/C8H12O2.CH4/c1-3-4-8(10)6-5-7(2)9;/h3-4H,5-6H2,1-2H3;1H4/b4-3+; |
| InChIKey | JWIQZYKRNKNNLL-BJILWQEISA-N |
| XLogP | 2.14 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methane;(E)-oct-6-ene-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;(E)-oct-6-ene-2,5-dione?
The IUPAC name of methane;(E)-oct-6-ene-2,5-dione (CID 159043306) is methane;(E)-oct-6-ene-2,5-dione.
What is the SMILES notation for methane;(E)-oct-6-ene-2,5-dione?
The canonical SMILES for methane;(E)-oct-6-ene-2,5-dione is C.C/C=C/C(=O)CCC(C)=O.
What is the InChIKey of methane;(E)-oct-6-ene-2,5-dione?
The InChIKey is JWIQZYKRNKNNLL-BJILWQEISA-N. The full InChI is InChI=1S/C8H12O2.CH4/c1-3-4-8(10)6-5-7(2)9;/h3-4H,5-6H2,1-2H3;1H4/b4-3+;.
What are the key properties of methane;(E)-oct-6-ene-2,5-dione?
methane;(E)-oct-6-ene-2,5-dione has a molecular weight of 156.22 g/mol, XLogP of 2.14, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;(E)-oct-6-ene-2,5-dione is sourced from PubChem (CID 159043306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).