C15H24O2 — CID 21242335
(2E,7E,11E)-13-hydroxy-7,11-dimethyltrideca-2,7,11-trien-4-one (PubChem CID 21242335) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (2E,7E,11E)-13-hydroxy-7,11-dimethyltrideca-2,7,11-trien-4-one.
| Compound Name | (2E,7E,11E)-13-hydroxy-7,11-dimethyltrideca-2,7,11-trien-4-one |
|---|---|
| PubChem CID | 21242335 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (2E,7E,11E)-13-hydroxy-7,11-dimethyltrideca-2,7,11-trien-4-one |
| SMILES | C/C=C/C(=O)CC/C(C)=C/CC/C(C)=C/CO |
| InChI | InChI=1S/C15H24O2/c1-4-6-15(17)10-9-13(2)7-5-8-14(3)11-12-16/h4,6-7,11,16H,5,8-10,12H2,1-3H3/b6-4+,13-7+,14-11+ |
| InChIKey | GCRIFDCDDGYCOD-JQUHHWQGSA-N |
| XLogP | 3.58 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|