9-hydroxy-3,7-dimethylnona-3,7-dienoic acid

C11H18O3 — CID 54505470

IUPAC9-hydroxy-3,7-dimethylnona-3,7-dienoic acid
SMILESCC(=CCO)CCC=C(C)CC(=O)O
InChIInChI=1S/C11H18O3/c1-9(6-7-12)4-3-5-10(2)8-11(13)14/h5-6,12H,3-4,7-8H2,1-2H3,(H,13,14)
InChIKeyYFJFMRMZFRGVEX-UHFFFAOYSA-N
MW198.26 g/mol
LogP2.13
Rot. Bonds6

About 9-hydroxy-3,7-dimethylnona-3,7-dienoic acid

9-hydroxy-3,7-dimethylnona-3,7-dienoic acid (PubChem CID 54505470) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is 9-hydroxy-3,7-dimethylnona-3,7-dienoic acid.

Molecular Properties

Compound Name9-hydroxy-3,7-dimethylnona-3,7-dienoic acid
PubChem CID54505470
Molecular FormulaC11H18O3
Molecular Weight198.26 g/mol
Exact Mass198.13
IUPAC Name9-hydroxy-3,7-dimethylnona-3,7-dienoic acid
SMILESCC(=CCO)CCC=C(C)CC(=O)O
InChIInChI=1S/C11H18O3/c1-9(6-7-12)4-3-5-10(2)8-11(13)14/h5-6,12H,3-4,7-8H2,1-2H3,(H,13,14)
InChIKeyYFJFMRMZFRGVEX-UHFFFAOYSA-N
XLogP2.13
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.26
LogP ≤ 52.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 9-hydroxy-3,7-dimethylnona-3,7-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 9-hydroxy-3,7-dimethylnona-3,7-dienoic acid?
The IUPAC name of 9-hydroxy-3,7-dimethylnona-3,7-dienoic acid (CID 54505470) is 9-hydroxy-3,7-dimethylnona-3,7-dienoic acid.
What is the SMILES notation for 9-hydroxy-3,7-dimethylnona-3,7-dienoic acid?
The canonical SMILES for 9-hydroxy-3,7-dimethylnona-3,7-dienoic acid is CC(=CCO)CCC=C(C)CC(=O)O.
What is the InChIKey of 9-hydroxy-3,7-dimethylnona-3,7-dienoic acid?
The InChIKey is YFJFMRMZFRGVEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O3/c1-9(6-7-12)4-3-5-10(2)8-11(13)14/h5-6,12H,3-4,7-8H2,1-2H3,(H,13,14).
What are the key properties of 9-hydroxy-3,7-dimethylnona-3,7-dienoic acid?
9-hydroxy-3,7-dimethylnona-3,7-dienoic acid has a molecular weight of 198.26 g/mol, XLogP of 2.13, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-hydroxy-3,7-dimethylnona-3,7-dienoic acid is sourced from PubChem (CID 54505470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).