C11H18O2 — CID 87428848
(3E,7E)-9-hydroxy-3,7-dimethylnona-3,7-dien-2-one (PubChem CID 87428848) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (3E,7E)-9-hydroxy-3,7-dimethylnona-3,7-dien-2-one.
| Compound Name | (3E,7E)-9-hydroxy-3,7-dimethylnona-3,7-dien-2-one |
|---|---|
| PubChem CID | 87428848 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (3E,7E)-9-hydroxy-3,7-dimethylnona-3,7-dien-2-one |
| SMILES | CC(=O)/C(C)=C/CC/C(C)=C/CO |
| InChI | InChI=1S/C11H18O2/c1-9(7-8-12)5-4-6-10(2)11(3)13/h6-7,12H,4-5,8H2,1-3H3/b9-7+,10-6+ |
| InChIKey | XTAZMRKHASYFBU-IDXDHNASSA-N |
| XLogP | 2.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|