C9H16O — CID 57183202
3-methylocta-2,6-dien-1-ol (PubChem CID 57183202) has the molecular formula C9H16O and a molecular weight of 140.23 g/mol. Its IUPAC name is 3-methylocta-2,6-dien-1-ol.
| Compound Name | 3-methylocta-2,6-dien-1-ol |
|---|---|
| PubChem CID | 57183202 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | 3-methylocta-2,6-dien-1-ol |
| SMILES | CC=CCCC(C)=CCO |
| InChI | InChI=1S/C9H16O/c1-3-4-5-6-9(2)7-8-10/h3-4,7,10H,5-6,8H2,1-2H3 |
| InChIKey | RDMNEYLXXQPRHD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|