C13H22O — CID 57126192
3-methyldodeca-2,6,10-trien-1-ol (PubChem CID 57126192) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is 3-methyldodeca-2,6,10-trien-1-ol.
| Compound Name | 3-methyldodeca-2,6,10-trien-1-ol |
|---|---|
| PubChem CID | 57126192 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | 3-methyldodeca-2,6,10-trien-1-ol |
| SMILES | CC=CCCC=CCCC(C)=CCO |
| InChI | InChI=1S/C13H22O/c1-3-4-5-6-7-8-9-10-13(2)11-12-14/h3-4,7-8,11,14H,5-6,9-10,12H2,1-2H3 |
| InChIKey | VZABKPJKAKVWSX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|