C15H26 — CID 139931040
6,11-dimethyltrideca-2,6,10-triene (PubChem CID 139931040) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is 6,11-dimethyltrideca-2,6,10-triene.
| Compound Name | 6,11-dimethyltrideca-2,6,10-triene |
|---|---|
| PubChem CID | 139931040 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | 6,11-dimethyltrideca-2,6,10-triene |
| SMILES | CC=CCCC(C)=CCCC=C(C)CC |
| InChI | InChI=1S/C15H26/c1-5-7-8-12-15(4)13-10-9-11-14(3)6-2/h5,7,11,13H,6,8-10,12H2,1-4H3 |
| InChIKey | XTSZCISUGVJNOH-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|