C14H25N — CID 135182583
(4E,8E)-N,5,9-trimethylundeca-4,8-dien-1-imine (PubChem CID 135182583) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is (4E,8E)-N,5,9-trimethylundeca-4,8-dien-1-imine.
| Compound Name | (4E,8E)-N,5,9-trimethylundeca-4,8-dien-1-imine |
|---|---|
| PubChem CID | 135182583 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | (4E,8E)-N,5,9-trimethylundeca-4,8-dien-1-imine |
| SMILES | CC/C(C)=C/CC/C(C)=C/CC/C=N/C |
| InChI | InChI=1S/C14H25N/c1-5-13(2)10-8-11-14(3)9-6-7-12-15-4/h9-10,12H,5-8,11H2,1-4H3/b13-10+,14-9+,15-12+ |
| InChIKey | FVKOWNGXDJRUCA-VOBGESDCSA-N |
| XLogP | 4.55 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|