C14H24O — CID 135383533
(6E,10E)-11-methyltrideca-6,10-dien-3-one (PubChem CID 135383533) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is (6E,10E)-11-methyltrideca-6,10-dien-3-one.
| Compound Name | (6E,10E)-11-methyltrideca-6,10-dien-3-one |
|---|---|
| PubChem CID | 135383533 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | (6E,10E)-11-methyltrideca-6,10-dien-3-one |
| SMILES | CCC(=O)CC/C=C/CC/C=C(\C)CC |
| InChI | InChI=1S/C14H24O/c1-4-13(3)11-9-7-6-8-10-12-14(15)5-2/h6,8,11H,4-5,7,9-10,12H2,1-3H3/b8-6+,13-11+ |
| InChIKey | VWWRNZMFCAVLRJ-VAFZVJGJSA-N |
| XLogP | 4.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|