C24H36O — CID 90126203
(6E,9E,12E,15E,18E,21Z)-tetracosa-6,9,12,15,18,21-hexaen-3-one (PubChem CID 90126203) has the molecular formula C24H36O and a molecular weight of 340.55 g/mol. Its IUPAC name is (6E,9E,12E,15E,18E,21Z)-tetracosa-6,9,12,15,18,21-hexaen-3-one.
| Compound Name | (6E,9E,12E,15E,18E,21Z)-tetracosa-6,9,12,15,18,21-hexaen-3-one |
|---|---|
| PubChem CID | 90126203 |
| Molecular Formula | C24H36O |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 340.28 |
| IUPAC Name | (6E,9E,12E,15E,18E,21Z)-tetracosa-6,9,12,15,18,21-hexaen-3-one |
| SMILES | CC/C=C\C/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCC(=O)CC |
| InChI | InChI=1S/C24H36O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24(25)4-2/h5-6,8-9,11-12,14-15,17-18,20-21H,3-4,7,10,13,16,19,22-23H2,1-2H3/b6-5-,9-8+,12-11+,15-14+,18-17+,21-20+ |
| InChIKey | JTDBOWPQNNWRMZ-ANYSCSBISA-N |
| XLogP | 7.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|