C27H42O — CID 140692029
(8Z,11Z,14Z,17Z,20Z,23Z)-2-methylhexacosa-8,11,14,17,20,23-hexaen-5-one (PubChem CID 140692029) has the molecular formula C27H42O and a molecular weight of 382.63 g/mol. Its IUPAC name is (8Z,11Z,14Z,17Z,20Z,23Z)-2-methylhexacosa-8,11,14,17,20,23-hexaen-5-one.
| Compound Name | (8Z,11Z,14Z,17Z,20Z,23Z)-2-methylhexacosa-8,11,14,17,20,23-hexaen-5-one |
|---|---|
| PubChem CID | 140692029 |
| Molecular Formula | C27H42O |
| Molecular Weight | 382.63 g/mol |
| Exact Mass | 382.32 |
| IUPAC Name | (8Z,11Z,14Z,17Z,20Z,23Z)-2-methylhexacosa-8,11,14,17,20,23-hexaen-5-one |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)CCC(C)C |
| InChI | InChI=1S/C27H42O/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-27(28)25-24-26(2)3/h5-6,8-9,11-12,14-15,17-18,20-21,26H,4,7,10,13,16,19,22-25H2,1-3H3/b6-5-,9-8-,12-11-,15-14-,18-17-,21-20- |
| InChIKey | ZELOUKRBSMQNED-YNUSHXQLSA-N |
| XLogP | 8.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.63 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|