C28H44O — CID 155632900
(8Z,11Z,14Z,17Z,20Z,23Z)-2-methylheptacosa-8,11,14,17,20,23-hexaen-5-one (PubChem CID 155632900) has the molecular formula C28H44O and a molecular weight of 396.66 g/mol. Its IUPAC name is (8Z,11Z,14Z,17Z,20Z,23Z)-2-methylheptacosa-8,11,14,17,20,23-hexaen-5-one.
| Compound Name | (8Z,11Z,14Z,17Z,20Z,23Z)-2-methylheptacosa-8,11,14,17,20,23-hexaen-5-one |
|---|---|
| PubChem CID | 155632900 |
| Molecular Formula | C28H44O |
| Molecular Weight | 396.66 g/mol |
| Exact Mass | 396.34 |
| IUPAC Name | (8Z,11Z,14Z,17Z,20Z,23Z)-2-methylheptacosa-8,11,14,17,20,23-hexaen-5-one |
| SMILES | CCC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)CCC(C)C |
| InChI | InChI=1S/C28H44O/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-28(29)26-25-27(2)3/h6-7,9-10,12-13,15-16,18-19,21-22,27H,4-5,8,11,14,17,20,23-26H2,1-3H3/b7-6-,10-9-,13-12-,16-15-,19-18-,22-21- |
| InChIKey | OMQCEFXJXDMQSA-WSDBEMKQSA-N |
| XLogP | 8.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.66 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|