C26H40O — CID 157466418
(7Z,10Z,13Z,16Z,19Z,22Z)-2-methylpentacosa-7,10,13,16,19,22-hexaen-4-one (PubChem CID 157466418) has the molecular formula C26H40O and a molecular weight of 368.61 g/mol. Its IUPAC name is (7Z,10Z,13Z,16Z,19Z,22Z)-2-methylpentacosa-7,10,13,16,19,22-hexaen-4-one.
| Compound Name | (7Z,10Z,13Z,16Z,19Z,22Z)-2-methylpentacosa-7,10,13,16,19,22-hexaen-4-one |
|---|---|
| PubChem CID | 157466418 |
| Molecular Formula | C26H40O |
| Molecular Weight | 368.61 g/mol |
| Exact Mass | 368.31 |
| IUPAC Name | (7Z,10Z,13Z,16Z,19Z,22Z)-2-methylpentacosa-7,10,13,16,19,22-hexaen-4-one |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)CC(C)C |
| InChI | InChI=1S/C26H40O/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-26(27)24-25(2)3/h5-6,8-9,11-12,14-15,17-18,20-21,25H,4,7,10,13,16,19,22-24H2,1-3H3/b6-5-,9-8-,12-11-,15-14-,18-17-,21-20- |
| InChIKey | BUNMSXBWBBOQDF-YNUSHXQLSA-N |
| XLogP | 8.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.61 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|