About undec-7-ene-2,4-dione
undec-7-ene-2,4-dione (PubChem CID 175206298) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is undec-7-ene-2,4-dione.
Molecular Properties
| Compound Name | undec-7-ene-2,4-dione |
| PubChem CID | 175206298 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | undec-7-ene-2,4-dione |
| SMILES | CCCC=CCCC(=O)CC(C)=O |
| InChI | InChI=1S/C11H18O2/c1-3-4-5-6-7-8-11(13)9-10(2)12/h5-6H,3-4,7-9H2,1-2H3 |
| InChIKey | RLNHFXBTCMIMIR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze undec-7-ene-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of undec-7-ene-2,4-dione?
The IUPAC name of undec-7-ene-2,4-dione (CID 175206298) is undec-7-ene-2,4-dione.
What is the SMILES notation for undec-7-ene-2,4-dione?
The canonical SMILES for undec-7-ene-2,4-dione is CCCC=CCCC(=O)CC(C)=O.
What is the InChIKey of undec-7-ene-2,4-dione?
The InChIKey is RLNHFXBTCMIMIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2/c1-3-4-5-6-7-8-11(13)9-10(2)12/h5-6H,3-4,7-9H2,1-2H3.
What are the key properties of undec-7-ene-2,4-dione?
undec-7-ene-2,4-dione has a molecular weight of 182.26 g/mol, XLogP of 2.67, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for undec-7-ene-2,4-dione is sourced from PubChem (CID 175206298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).