C11H18O — CID 23366329
(4E,7E)-undeca-4,7-dien-6-one (PubChem CID 23366329) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is (4E,7E)-undeca-4,7-dien-6-one.
| Compound Name | (4E,7E)-undeca-4,7-dien-6-one |
|---|---|
| PubChem CID | 23366329 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (4E,7E)-undeca-4,7-dien-6-one |
| SMILES | CCC/C=C/C(=O)/C=C/CCC |
| InChI | InChI=1S/C11H18O/c1-3-5-7-9-11(12)10-8-6-4-2/h7-10H,3-6H2,1-2H3/b9-7+,10-8+ |
| InChIKey | HOLZYGBUEVHTBB-FIFLTTCUSA-N |
| XLogP | 3.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|