About hept-3-en-2-one;oct-3-en-2-one
hept-3-en-2-one;oct-3-en-2-one (PubChem CID 159843047) has the molecular formula C15H26O2
and a molecular weight of 238.37 g/mol. Its IUPAC name is hept-3-en-2-one;oct-3-en-2-one.
Molecular Properties
| Compound Name | hept-3-en-2-one;oct-3-en-2-one |
| PubChem CID | 159843047 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | hept-3-en-2-one;oct-3-en-2-one |
| SMILES | CCCC=CC(C)=O.CCCCC=CC(C)=O |
| InChI | InChI=1S/C8H14O.C7H12O/c1-3-4-5-6-7-8(2)9;1-3-4-5-6-7(2)8/h6-7H,3-5H2,1-2H3;5-6H,3-4H2,1-2H3 |
| InChIKey | NOXVINDDBLFKQS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze hept-3-en-2-one;oct-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hept-3-en-2-one;oct-3-en-2-one?
The IUPAC name of hept-3-en-2-one;oct-3-en-2-one (CID 159843047) is hept-3-en-2-one;oct-3-en-2-one.
What is the SMILES notation for hept-3-en-2-one;oct-3-en-2-one?
The canonical SMILES for hept-3-en-2-one;oct-3-en-2-one is CCCC=CC(C)=O.CCCCC=CC(C)=O.
What is the InChIKey of hept-3-en-2-one;oct-3-en-2-one?
The InChIKey is NOXVINDDBLFKQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O.C7H12O/c1-3-4-5-6-7-8(2)9;1-3-4-5-6-7(2)8/h6-7H,3-5H2,1-2H3;5-6H,3-4H2,1-2H3.
What are the key properties of hept-3-en-2-one;oct-3-en-2-one?
hept-3-en-2-one;oct-3-en-2-one has a molecular weight of 238.37 g/mol, XLogP of 4.25, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hept-3-en-2-one;oct-3-en-2-one is sourced from PubChem (CID 159843047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).