C14H22O2 — CID 24974321
(3E,11E)-tetradeca-3,11-diene-2,13-dione (PubChem CID 24974321) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (3E,11E)-tetradeca-3,11-diene-2,13-dione.
| Compound Name | (3E,11E)-tetradeca-3,11-diene-2,13-dione |
|---|---|
| PubChem CID | 24974321 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (3E,11E)-tetradeca-3,11-diene-2,13-dione |
| SMILES | CC(=O)/C=C/CCCCCC/C=C/C(C)=O |
| InChI | InChI=1S/C14H22O2/c1-13(15)11-9-7-5-3-4-6-8-10-12-14(2)16/h9-12H,3-8H2,1-2H3/b11-9+,12-10+ |
| InChIKey | DUSXNMUAKGWBEC-WGDLNXRISA-N |
| XLogP | 3.62 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|