About decan-3-one;dec-3-en-2-one
decan-3-one;dec-3-en-2-one (PubChem CID 174922599) has the molecular formula C20H38O2
and a molecular weight of 310.52 g/mol. Its IUPAC name is decan-3-one;dec-3-en-2-one.
Molecular Properties
| Compound Name | decan-3-one;dec-3-en-2-one |
| PubChem CID | 174922599 |
| Molecular Formula | C20H38O2 |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 310.29 |
| IUPAC Name | decan-3-one;dec-3-en-2-one |
| SMILES | CCCCCCC=CC(C)=O.CCCCCCCC(=O)CC |
| InChI | InChI=1S/C10H18O.C10H20O/c1-3-4-5-6-7-8-9-10(2)11;1-3-5-6-7-8-9-10(11)4-2/h8-9H,3-7H2,1-2H3;3-9H2,1-2H3 |
| InChIKey | NMXQIWVIWYUUQZ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze decan-3-one;dec-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decan-3-one;dec-3-en-2-one?
The IUPAC name of decan-3-one;dec-3-en-2-one (CID 174922599) is decan-3-one;dec-3-en-2-one.
What is the SMILES notation for decan-3-one;dec-3-en-2-one?
The canonical SMILES for decan-3-one;dec-3-en-2-one is CCCCCCC=CC(C)=O.CCCCCCCC(=O)CC.
What is the InChIKey of decan-3-one;dec-3-en-2-one?
The InChIKey is NMXQIWVIWYUUQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O.C10H20O/c1-3-4-5-6-7-8-9-10(2)11;1-3-5-6-7-8-9-10(11)4-2/h8-9H,3-7H2,1-2H3;3-9H2,1-2H3.
What are the key properties of decan-3-one;dec-3-en-2-one?
decan-3-one;dec-3-en-2-one has a molecular weight of 310.52 g/mol, XLogP of 6.43, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decan-3-one;dec-3-en-2-one is sourced from PubChem (CID 174922599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).