About gold;non-3-en-2-one
gold;non-3-en-2-one (PubChem CID 159452579) has the molecular formula C9H16AuO
and a molecular weight of 337.19 g/mol. Its IUPAC name is gold;non-3-en-2-one.
Molecular Properties
| Compound Name | gold;non-3-en-2-one |
| PubChem CID | 159452579 |
| Molecular Formula | C9H16AuO |
| Molecular Weight | 337.19 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | gold;non-3-en-2-one |
| SMILES | CCCCCC=CC(C)=O.[Au] |
| InChI | InChI=1S/C9H16O.Au/c1-3-4-5-6-7-8-9(2)10;/h7-8H,3-6H2,1-2H3; |
| InChIKey | LTOIFZIQCULAIJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.19 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze gold;non-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold;non-3-en-2-one?
The IUPAC name of gold;non-3-en-2-one (CID 159452579) is gold;non-3-en-2-one.
What is the SMILES notation for gold;non-3-en-2-one?
The canonical SMILES for gold;non-3-en-2-one is CCCCCC=CC(C)=O.[Au].
What is the InChIKey of gold;non-3-en-2-one?
The InChIKey is LTOIFZIQCULAIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O.Au/c1-3-4-5-6-7-8-9(2)10;/h7-8H,3-6H2,1-2H3;.
What are the key properties of gold;non-3-en-2-one?
gold;non-3-en-2-one has a molecular weight of 337.19 g/mol, XLogP of 2.71, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for gold;non-3-en-2-one is sourced from PubChem (CID 159452579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).