About hexane;hex-3-en-2-one
hexane;hex-3-en-2-one (PubChem CID 159035878) has the molecular formula C12H24O
and a molecular weight of 184.32 g/mol. Its IUPAC name is hexane;hex-3-en-2-one.
Molecular Properties
| Compound Name | hexane;hex-3-en-2-one |
| PubChem CID | 159035878 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | hexane;hex-3-en-2-one |
| SMILES | CCC=CC(C)=O.CCCCCC |
| InChI | InChI=1S/C6H10O.C6H14/c1-3-4-5-6(2)7;1-3-5-6-4-2/h4-5H,3H2,1-2H3;3-6H2,1-2H3 |
| InChIKey | JVLKTMVTEZHACS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze hexane;hex-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexane;hex-3-en-2-one?
The IUPAC name of hexane;hex-3-en-2-one (CID 159035878) is hexane;hex-3-en-2-one.
What is the SMILES notation for hexane;hex-3-en-2-one?
The canonical SMILES for hexane;hex-3-en-2-one is CCC=CC(C)=O.CCCCCC.
What is the InChIKey of hexane;hex-3-en-2-one?
The InChIKey is JVLKTMVTEZHACS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O.C6H14/c1-3-4-5-6(2)7;1-3-5-6-4-2/h4-5H,3H2,1-2H3;3-6H2,1-2H3.
What are the key properties of hexane;hex-3-en-2-one?
hexane;hex-3-en-2-one has a molecular weight of 184.32 g/mol, XLogP of 4.13, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexane;hex-3-en-2-one is sourced from PubChem (CID 159035878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).