C8H12O — CID 6428552
(3Z,5E)-octa-3,5-dien-2-one (PubChem CID 6428552) has the molecular formula C8H12O and a molecular weight of 124.18 g/mol. Its IUPAC name is (3Z,5E)-octa-3,5-dien-2-one.
| Compound Name | (3Z,5E)-octa-3,5-dien-2-one |
|---|---|
| PubChem CID | 6428552 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | (3Z,5E)-octa-3,5-dien-2-one |
| SMILES | CC/C=C/C=C\C(C)=O |
| InChI | InChI=1S/C8H12O/c1-3-4-5-6-7-8(2)9/h4-7H,3H2,1-2H3/b5-4+,7-6- |
| InChIKey | LWRKMRFJEUFXIB-DEQVHDEQSA-N |
| XLogP | 2.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|