About dialuminum;non-3-en-2-one;tris(oxygen(2-))
dialuminum;non-3-en-2-one;tris(oxygen(2-)) (PubChem CID 158998324) has the molecular formula C9H16Al2O4
and a molecular weight of 242.19 g/mol. Its IUPAC name is dialuminum;non-3-en-2-one;tris(oxygen(2-)).
Molecular Properties
| Compound Name | dialuminum;non-3-en-2-one;tris(oxygen(2-)) |
| PubChem CID | 158998324 |
| Molecular Formula | C9H16Al2O4 |
| Molecular Weight | 242.19 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | dialuminum;non-3-en-2-one;tris(oxygen(2-)) |
| SMILES | CCCCCC=CC(C)=O.[Al+3].[Al+3].[O-2].[O-2].[O-2] |
| InChI | InChI=1S/C9H16O.2Al.3O/c1-3-4-5-6-7-8-9(2)10;;;;;/h7-8H,3-6H2,1-2H3;;;;;/q;2*+3;3*-2 |
| InChIKey | IBUUKSADZAJQRK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 102.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.19 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dialuminum;non-3-en-2-one;tris(oxygen(2-)) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dialuminum;non-3-en-2-one;tris(oxygen(2-))?
The IUPAC name of dialuminum;non-3-en-2-one;tris(oxygen(2-)) (CID 158998324) is dialuminum;non-3-en-2-one;tris(oxygen(2-)).
What is the SMILES notation for dialuminum;non-3-en-2-one;tris(oxygen(2-))?
The canonical SMILES for dialuminum;non-3-en-2-one;tris(oxygen(2-)) is CCCCCC=CC(C)=O.[Al+3].[Al+3].[O-2].[O-2].[O-2].
What is the InChIKey of dialuminum;non-3-en-2-one;tris(oxygen(2-))?
The InChIKey is IBUUKSADZAJQRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O.2Al.3O/c1-3-4-5-6-7-8-9(2)10;;;;;/h7-8H,3-6H2,1-2H3;;;;;/q;2*+3;3*-2.
What are the key properties of dialuminum;non-3-en-2-one;tris(oxygen(2-))?
dialuminum;non-3-en-2-one;tris(oxygen(2-)) has a molecular weight of 242.19 g/mol, XLogP of 1.59, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dialuminum;non-3-en-2-one;tris(oxygen(2-)) is sourced from PubChem (CID 158998324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).