About 1-deuteriodec-3-en-2-one
1-deuteriodec-3-en-2-one (PubChem CID 175786333) has the molecular formula C10H18O
and a molecular weight of 155.26 g/mol. Its IUPAC name is 1-deuteriodec-3-en-2-one.
Molecular Properties
| Compound Name | 1-deuteriodec-3-en-2-one |
| PubChem CID | 175786333 |
| Molecular Formula | C10H18O |
| Molecular Weight | 155.26 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | 1-deuteriodec-3-en-2-one |
| SMILES | [2H]CC(=O)C=CCCCCCC |
| InChI | InChI=1S/C10H18O/c1-3-4-5-6-7-8-9-10(2)11/h8-9H,3-7H2,1-2H3/i2D |
| InChIKey | JRPDANVNRUIUAB-VMNATFBRSA-N |
| XLogP | 3.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.26 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-deuteriodec-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-deuteriodec-3-en-2-one?
The IUPAC name of 1-deuteriodec-3-en-2-one (CID 175786333) is 1-deuteriodec-3-en-2-one.
What is the SMILES notation for 1-deuteriodec-3-en-2-one?
The canonical SMILES for 1-deuteriodec-3-en-2-one is [2H]CC(=O)C=CCCCCCC.
What is the InChIKey of 1-deuteriodec-3-en-2-one?
The InChIKey is JRPDANVNRUIUAB-VMNATFBRSA-N. The full InChI is InChI=1S/C10H18O/c1-3-4-5-6-7-8-9-10(2)11/h8-9H,3-7H2,1-2H3/i2D.
What are the key properties of 1-deuteriodec-3-en-2-one?
1-deuteriodec-3-en-2-one has a molecular weight of 155.26 g/mol, XLogP of 3.10, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-deuteriodec-3-en-2-one is sourced from PubChem (CID 175786333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).